![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.JPG){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 000_0142.JPG | 2019-11-01 17:01 | 169K | |
| 1 Cut Cabin.JPG | 2019-11-01 17:01 | 96K | |
| 2 redesign , use scrap to position mast.bmp | 2019-11-01 17:01 | 3.5M | |
| 3. Front cabin structure.JPG | 2019-11-01 17:01 | 102K | |
| 4. Front windows.JPG | 2019-11-01 17:01 | 180K | |
| 5.Windows done.JPG | 2019-11-01 17:01 | 160K | |
| 6. grabrails.JPG | 2019-11-01 17:01 | 174K | |
| 7 Support beams for mast box.JPG | 2019-11-01 17:01 | 165K | |
| 8 forward cockpit and mast completed (2).JPG | 2019-11-01 17:01 | 170K | |
| 9.View forward.JPG | 2019-11-01 17:01 | 257K | |
| 10. Top view, mast storage.JPG | 2019-11-01 17:01 | 171K | |
| 11 mast storage.JPG | 2019-11-01 17:01 | 211K | |
| 12. Aft view. note curve in roof.JPG | 2019-11-01 17:01 | 168K | |
| 13 window pattern.JPG | 2019-11-01 17:01 | 164K | |
| 14 drop in.JPG | 2019-11-01 17:01 | 177K | |
